C24H22N4O6 — CID 46237292
8-hydroxy-N-[4-[(8-hydroxy-2-iminochromene-3-carbonyl)amino]butyl]-2-iminochromene-3-carboxamide (PubChem CID 46237292) has the molecular formula C24H22N4O6 and a molecular weight of 462.46 g/mol. Its IUPAC name is 8-hydroxy-N-[4-[(8-hydroxy-2-iminochromene-3-carbonyl)amino]butyl]-2-iminochromene-3-carboxamide.
| Compound Name | 8-hydroxy-N-[4-[(8-hydroxy-2-iminochromene-3-carbonyl)amino]butyl]-2-iminochromene-3-carboxamide |
|---|---|
| PubChem CID | 46237292 |
| Molecular Formula | C24H22N4O6 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 8-hydroxy-N-[4-[(8-hydroxy-2-iminochromene-3-carbonyl)amino]butyl]-2-iminochromene-3-carboxamide |
| SMILES | [H]/N=c1\oc2c(O)cccc2cc1C(=O)NCCCCNC(=O)c1cc2cccc(O)c2o/c1=N\[H] |
| InChI | InChI=1S/C24H22N4O6/c25-21-15(11-13-5-3-7-17(29)19(13)33-21)23(31)27-9-1-2-10-28-24(32)16-12-14-6-4-8-18(30)20(14)34-22(16)26/h3-8,11-12,25-26,29-30H,1-2,9-10H2,(H,27,31)(H,28,32)/b25-21-,26-22- |
| InChIKey | WRMBWFJLZHVSDP-ORFRIDJFSA-N |
| XLogP | 2.49 |
| TPSA | 172.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|