C21H22N2O5 — CID 17379757
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-imino-8-methoxychromene-3-carboxamide (PubChem CID 17379757) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-imino-8-methoxychromene-3-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-imino-8-methoxychromene-3-carboxamide |
|---|---|
| PubChem CID | 17379757 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-imino-8-methoxychromene-3-carboxamide |
| SMILES | [H]/N=c1\oc2c(OC)cccc2cc1C(=O)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H22N2O5/c1-25-16-8-7-13(11-18(16)27-3)9-10-23-21(24)15-12-14-5-4-6-17(26-2)19(14)28-20(15)22/h4-8,11-12,22H,9-10H2,1-3H3,(H,23,24)/b22-20- |
| InChIKey | NCVIDUAKDWVSPS-XDOYNYLZSA-N |
| XLogP | 2.91 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |