C19H16N2O5 — CID 19289020
N-(1,3-benzodioxol-5-ylmethyl)-2-imino-8-methoxychromene-3-carboxamide (PubChem CID 19289020) has the molecular formula C19H16N2O5 and a molecular weight of 352.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-imino-8-methoxychromene-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-imino-8-methoxychromene-3-carboxamide |
|---|---|
| PubChem CID | 19289020 |
| Molecular Formula | C19H16N2O5 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-imino-8-methoxychromene-3-carboxamide |
| SMILES | [H]/N=c1\oc2c(OC)cccc2cc1C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H16N2O5/c1-23-15-4-2-3-12-8-13(18(20)26-17(12)15)19(22)21-9-11-5-6-14-16(7-11)25-10-24-14/h2-8,20H,9-10H2,1H3,(H,21,22)/b20-18- |
| InChIKey | COLYECKUHVQBRK-ZZEZOPTASA-N |
| XLogP | 2.58 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |