C25H21N3O7S — CID 3627019
N-(1,3-benzodioxol-5-ylmethyl)-N'-[4-(8-methoxy-2-oxochromen-3-yl)-1,3-thiazol-2-yl]butanediamide (PubChem CID 3627019) has the molecular formula C25H21N3O7S and a molecular weight of 507.52 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N'-[4-(8-methoxy-2-oxochromen-3-yl)-1,3-thiazol-2-yl]butanediamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[4-(8-methoxy-2-oxochromen-3-yl)-1,3-thiazol-2-yl]butanediamide |
|---|---|
| PubChem CID | 3627019 |
| Molecular Formula | C25H21N3O7S |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N'-[4-(8-methoxy-2-oxochromen-3-yl)-1,3-thiazol-2-yl]butanediamide |
| SMILES | COc1cccc2cc(-c3csc(NC(=O)CCC(=O)NCc4ccc5c(c4)OCO5)n3)c(=O)oc12 |
| InChI | InChI=1S/C25H21N3O7S/c1-32-19-4-2-3-15-10-16(24(31)35-23(15)19)17-12-36-25(27-17)28-22(30)8-7-21(29)26-11-14-5-6-18-20(9-14)34-13-33-18/h2-6,9-10,12H,7-8,11,13H2,1H3,(H,26,29)(H,27,28,30) |
| InChIKey | WNMPYLJCMJHZJV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 128.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|