C23H24N4O6S — CID 3627023
1-[4-[[4-(8-methoxy-2-oxochromen-3-yl)-1,3-thiazol-2-yl]amino]-4-oxobutanoyl]piperidine-4-carboxamide (PubChem CID 3627023) has the molecular formula C23H24N4O6S and a molecular weight of 484.53 g/mol. Its IUPAC name is 1-[4-[[4-(8-methoxy-2-oxochromen-3-yl)-1,3-thiazol-2-yl]amino]-4-oxobutanoyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[[4-(8-methoxy-2-oxochromen-3-yl)-1,3-thiazol-2-yl]amino]-4-oxobutanoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3627023 |
| Molecular Formula | C23H24N4O6S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 1-[4-[[4-(8-methoxy-2-oxochromen-3-yl)-1,3-thiazol-2-yl]amino]-4-oxobutanoyl]piperidine-4-carboxamide |
| SMILES | COc1cccc2cc(-c3csc(NC(=O)CCC(=O)N4CCC(C(N)=O)CC4)n3)c(=O)oc12 |
| InChI | InChI=1S/C23H24N4O6S/c1-32-17-4-2-3-14-11-15(22(31)33-20(14)17)16-12-34-23(25-16)26-18(28)5-6-19(29)27-9-7-13(8-10-27)21(24)30/h2-4,11-13H,5-10H2,1H3,(H2,24,30)(H,25,26,28) |
| InChIKey | BVBZQIMTIUOYHZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|