C16H19N3O2S — CID 46907682
1-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide (PubChem CID 46907682) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46907682 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 1-[4-(2-methoxyphenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide |
| SMILES | COc1ccccc1-c1csc(N2CCC(C(N)=O)CC2)n1 |
| InChI | InChI=1S/C16H19N3O2S/c1-21-14-5-3-2-4-12(14)13-10-22-16(18-13)19-8-6-11(7-9-19)15(17)20/h2-5,10-11H,6-9H2,1H3,(H2,17,20) |
| InChIKey | BIIBCCPKYIQMAP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |