C17H20N4O2S — CID 46907660
1-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide (PubChem CID 46907660) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 1-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46907660 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-[4-(4-acetamidophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide |
| SMILES | CC(=O)Nc1ccc(-c2csc(N3CCC(C(N)=O)CC3)n2)cc1 |
| InChI | InChI=1S/C17H20N4O2S/c1-11(22)19-14-4-2-12(3-5-14)15-10-24-17(20-15)21-8-6-13(7-9-21)16(18)23/h2-5,10,13H,6-9H2,1H3,(H2,18,23)(H,19,22) |
| InChIKey | UEQMGBUOQIMFCR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |