C18H23N3O2S — CID 46907689
1-[4-(4-propan-2-yloxyphenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide (PubChem CID 46907689) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-[4-(4-propan-2-yloxyphenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[4-(4-propan-2-yloxyphenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46907689 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 1-[4-(4-propan-2-yloxyphenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide |
| SMILES | CC(C)Oc1ccc(-c2csc(N3CCC(C(N)=O)CC3)n2)cc1 |
| InChI | InChI=1S/C18H23N3O2S/c1-12(2)23-15-5-3-13(4-6-15)16-11-24-18(20-16)21-9-7-14(8-10-21)17(19)22/h3-6,11-12,14H,7-10H2,1-2H3,(H2,19,22) |
| InChIKey | LORWWPLQPMGJSR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |