C15H15Cl2N3OS — CID 623279
1-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide (PubChem CID 623279) has the molecular formula C15H15Cl2N3OS and a molecular weight of 356.28 g/mol. Its IUPAC name is 1-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 623279 |
| Molecular Formula | C15H15Cl2N3OS |
| Molecular Weight | 356.28 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 1-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(c2nc(-c3ccc(Cl)cc3Cl)cs2)CC1 |
| InChI | InChI=1S/C15H15Cl2N3OS/c16-10-1-2-11(12(17)7-10)13-8-22-15(19-13)20-5-3-9(4-6-20)14(18)21/h1-2,7-9H,3-6H2,(H2,18,21) |
| InChIKey | GVYMYTNQSCUUQV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |