C15H15FN2O2S — CID 122047336
1-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxylic acid (PubChem CID 122047336) has the molecular formula C15H15FN2O2S and a molecular weight of 306.36 g/mol. Its IUPAC name is 1-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 122047336 |
| Molecular Formula | C15H15FN2O2S |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 1-[4-(2-fluorophenyl)-1,3-thiazol-2-yl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2nc(-c3ccccc3F)cs2)CC1 |
| InChI | InChI=1S/C15H15FN2O2S/c16-12-4-2-1-3-11(12)13-9-21-15(17-13)18-7-5-10(6-8-18)14(19)20/h1-4,9-10H,5-8H2,(H,19,20) |
| InChIKey | NVYMWIWOONDFLU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |