C14H15FN2OS — CID 129303196
2-fluoro-6-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenol (PubChem CID 129303196) has the molecular formula C14H15FN2OS and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-fluoro-6-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenol.
| Compound Name | 2-fluoro-6-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenol |
|---|---|
| PubChem CID | 129303196 |
| Molecular Formula | C14H15FN2OS |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-fluoro-6-(2-piperidin-1-yl-1,3-thiazol-4-yl)phenol |
| SMILES | Oc1c(F)cccc1-c1csc(N2CCCCC2)n1 |
| InChI | InChI=1S/C14H15FN2OS/c15-11-6-4-5-10(13(11)18)12-9-19-14(16-12)17-7-2-1-3-8-17/h4-6,9,18H,1-3,7-8H2 |
| InChIKey | AZZADWAZYJZOLH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |