About 4-(2-piperazin-1-yl-1,3-thiazol-4-yl)benzene-1,3-diol
4-(2-piperazin-1-yl-1,3-thiazol-4-yl)benzene-1,3-diol (PubChem CID 122668656) has the molecular formula C13H15N3O2S
and a molecular weight of 277.35 g/mol. Its IUPAC name is 4-(2-piperazin-1-yl-1,3-thiazol-4-yl)benzene-1,3-diol.
Molecular Properties
| Compound Name | 4-(2-piperazin-1-yl-1,3-thiazol-4-yl)benzene-1,3-diol |
| PubChem CID | 122668656 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-(2-piperazin-1-yl-1,3-thiazol-4-yl)benzene-1,3-diol |
| SMILES | Oc1ccc(-c2csc(N3CCNCC3)n2)c(O)c1 |
| InChI | InChI=1S/C13H15N3O2S/c17-9-1-2-10(12(18)7-9)11-8-19-13(15-11)16-5-3-14-4-6-16/h1-2,7-8,14,17-18H,3-6H2 |
| InChIKey | BZRDWJXINOSPNB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2-piperazin-1-yl-1,3-thiazol-4-yl)benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-piperazin-1-yl-1,3-thiazol-4-yl)benzene-1,3-diol?
The IUPAC name of 4-(2-piperazin-1-yl-1,3-thiazol-4-yl)benzene-1,3-diol (CID 122668656) is 4-(2-piperazin-1-yl-1,3-thiazol-4-yl)benzene-1,3-diol.
What is the SMILES notation for 4-(2-piperazin-1-yl-1,3-thiazol-4-yl)benzene-1,3-diol?
The canonical SMILES for 4-(2-piperazin-1-yl-1,3-thiazol-4-yl)benzene-1,3-diol is Oc1ccc(-c2csc(N3CCNCC3)n2)c(O)c1.
What is the InChIKey of 4-(2-piperazin-1-yl-1,3-thiazol-4-yl)benzene-1,3-diol?
The InChIKey is BZRDWJXINOSPNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O2S/c17-9-1-2-10(12(18)7-9)11-8-19-13(15-11)16-5-3-14-4-6-16/h1-2,7-8,14,17-18H,3-6H2.
What are the key properties of 4-(2-piperazin-1-yl-1,3-thiazol-4-yl)benzene-1,3-diol?
4-(2-piperazin-1-yl-1,3-thiazol-4-yl)benzene-1,3-diol has a molecular weight of 277.35 g/mol, XLogP of 1.63, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-piperazin-1-yl-1,3-thiazol-4-yl)benzene-1,3-diol is sourced from PubChem (CID 122668656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).