C32H34N4O4S2 — CID 158841601
4-[2-[(3,5-dimethylphenyl)methyl]-1,3-thiazol-4-yl]benzene-1,3-diol;4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzene-1,3-diol (PubChem CID 158841601) has the molecular formula C32H34N4O4S2 and a molecular weight of 602.78 g/mol. Its IUPAC name is 4-[2-[(3,5-dimethylphenyl)methyl]-1,3-thiazol-4-yl]benzene-1,3-diol;4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzene-1,3-diol.
| Compound Name | 4-[2-[(3,5-dimethylphenyl)methyl]-1,3-thiazol-4-yl]benzene-1,3-diol;4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 158841601 |
| Molecular Formula | C32H34N4O4S2 |
| Molecular Weight | 602.78 g/mol |
| Exact Mass | 602.20 |
| IUPAC Name | 4-[2-[(3,5-dimethylphenyl)methyl]-1,3-thiazol-4-yl]benzene-1,3-diol;4-[2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-yl]benzene-1,3-diol |
| SMILES | CN1CCN(c2nc(-c3ccc(O)cc3O)cs2)CC1.Cc1cc(C)cc(Cc2nc(-c3ccc(O)cc3O)cs2)c1 |
| InChI | InChI=1S/C18H17NO2S.C14H17N3O2S/c1-11-5-12(2)7-13(6-11)8-18-19-16(10-22-18)15-4-3-14(20)9-17(15)21;1-16-4-6-17(7-5-16)14-15-12(9-20-14)11-3-2-10(18)8-13(11)19/h3-7,9-10,20-21H,8H2,1-2H3;2-3,8-9,18-19H,4-7H2,1H3 |
| InChIKey | IYHUBWDDZBUCIT-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.78 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |