C15H19N3O2S — CID 122668603
4-[2-(4-ethylpiperazin-1-yl)-1,3-thiazol-4-yl]benzene-1,3-diol (PubChem CID 122668603) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 4-[2-(4-ethylpiperazin-1-yl)-1,3-thiazol-4-yl]benzene-1,3-diol.
| Compound Name | 4-[2-(4-ethylpiperazin-1-yl)-1,3-thiazol-4-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 122668603 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 4-[2-(4-ethylpiperazin-1-yl)-1,3-thiazol-4-yl]benzene-1,3-diol |
| SMILES | CCN1CCN(c2nc(-c3ccc(O)cc3O)cs2)CC1 |
| InChI | InChI=1S/C15H19N3O2S/c1-2-17-5-7-18(8-6-17)15-16-13(10-21-15)12-4-3-11(19)9-14(12)20/h3-4,9-10,19-20H,2,5-8H2,1H3 |
| InChIKey | NAHAHEJWRCAWCK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 59.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |