C14H18N3O2S+ — CID 8895584
4-[2-(4-methylpiperazin-4-ium-1-yl)-1,3-thiazol-4-yl]benzene-1,2-diol (PubChem CID 8895584) has the molecular formula C14H18N3O2S+ and a molecular weight of 292.38 g/mol. Its IUPAC name is 4-[2-(4-methylpiperazin-4-ium-1-yl)-1,3-thiazol-4-yl]benzene-1,2-diol.
| Compound Name | 4-[2-(4-methylpiperazin-4-ium-1-yl)-1,3-thiazol-4-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 8895584 |
| Molecular Formula | C14H18N3O2S+ |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-[2-(4-methylpiperazin-4-ium-1-yl)-1,3-thiazol-4-yl]benzene-1,2-diol |
| SMILES | C[NH+]1CCN(c2nc(-c3ccc(O)c(O)c3)cs2)CC1 |
| InChI | InChI=1S/C14H17N3O2S/c1-16-4-6-17(7-5-16)14-15-11(9-20-14)10-2-3-12(18)13(19)8-10/h2-3,8-9,18-19H,4-7H2,1H3/p+1 |
| InChIKey | RHRQDVGKYZMNJA-UHFFFAOYSA-O |
| XLogP | 0.56 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|