C16H18N2O2S — CID 60528777
4-(1,3-benzodioxol-5-yl)-2-(4-methylpiperidin-1-yl)-1,3-thiazole (PubChem CID 60528777) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-(4-methylpiperidin-1-yl)-1,3-thiazole.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-(4-methylpiperidin-1-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 60528777 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-(4-methylpiperidin-1-yl)-1,3-thiazole |
| SMILES | CC1CCN(c2nc(-c3ccc4c(c3)OCO4)cs2)CC1 |
| InChI | InChI=1S/C16H18N2O2S/c1-11-4-6-18(7-5-11)16-17-13(9-21-16)12-2-3-14-15(8-12)20-10-19-14/h2-3,8-9,11H,4-7,10H2,1H3 |
| InChIKey | SLWNLZXGNUPEGQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |