C15H17ClN2O2S — CID 120558243
4-(1,3-benzodioxol-5-yl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride (PubChem CID 120558243) has the molecular formula C15H17ClN2O2S and a molecular weight of 324.83 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride |
|---|---|
| PubChem CID | 120558243 |
| Molecular Formula | C15H17ClN2O2S |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride |
| SMILES | Cl.c1cc2c(cc1-c1csc(C3CCNCC3)n1)OCO2 |
| InChI | InChI=1S/C15H16N2O2S.ClH/c1-2-13-14(19-9-18-13)7-11(1)12-8-20-15(17-12)10-3-5-16-6-4-10;/h1-2,7-8,10,16H,3-6,9H2;1H |
| InChIKey | SEOHSAMCQWWVNC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |