C21H18N2O3S — CID 46394881
N-(1,3-benzodioxol-5-ylmethyl)-4-(2-cyclopropyl-1,3-thiazol-4-yl)benzamide (PubChem CID 46394881) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-(2-cyclopropyl-1,3-thiazol-4-yl)benzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-(2-cyclopropyl-1,3-thiazol-4-yl)benzamide |
|---|---|
| PubChem CID | 46394881 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-(2-cyclopropyl-1,3-thiazol-4-yl)benzamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1ccc(-c2csc(C3CC3)n2)cc1 |
| InChI | InChI=1S/C21H18N2O3S/c24-20(22-10-13-1-8-18-19(9-13)26-12-25-18)15-4-2-14(3-5-15)17-11-27-21(23-17)16-6-7-16/h1-5,8-9,11,16H,6-7,10,12H2,(H,22,24) |
| InChIKey | PEFUJKYUFSNYBS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |