C14H12N2O3 — CID 2089022
N-(1,3-benzodioxol-5-ylmethyl)pyridine-4-carboxamide (PubChem CID 2089022) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)pyridine-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 2089022 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)pyridine-4-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1ccncc1 |
| InChI | InChI=1S/C14H12N2O3/c17-14(11-3-5-15-6-4-11)16-8-10-1-2-12-13(7-10)19-9-18-12/h1-7H,8-9H2,(H,16,17) |
| InChIKey | UQVOTJYRANFENB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |