C15H12N2O5 — CID 758504
N-(1,3-benzodioxol-5-ylmethyl)-4-nitrobenzamide (PubChem CID 758504) has the molecular formula C15H12N2O5 and a molecular weight of 300.27 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-nitrobenzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 758504 |
| Molecular Formula | C15H12N2O5 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-nitrobenzamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H12N2O5/c18-15(11-2-4-12(5-3-11)17(19)20)16-8-10-1-6-13-14(7-10)22-9-21-13/h1-7H,8-9H2,(H,16,18) |
| InChIKey | YCSMAKFJFYGZSF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|