C19H21N3O8 — CID 22467580
N-(1,3-benzodioxol-5-ylmethyl)-2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-nitrobenzamide (PubChem CID 22467580) has the molecular formula C19H21N3O8 and a molecular weight of 419.39 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-nitrobenzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-nitrobenzamide |
|---|---|
| PubChem CID | 22467580 |
| Molecular Formula | C19H21N3O8 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-5-nitrobenzamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1cc([N+](=O)[O-])ccc1NC(CO)(CO)CO |
| InChI | InChI=1S/C19H21N3O8/c23-8-19(9-24,10-25)21-15-3-2-13(22(27)28)6-14(15)18(26)20-7-12-1-4-16-17(5-12)30-11-29-16/h1-6,21,23-25H,7-11H2,(H,20,26) |
| InChIKey | OMMBRPCLNIZIDT-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 163.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|