C18H19N3O5 — CID 55454611
N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-2-(methylamino)-5-nitrobenzamide (PubChem CID 55454611) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-2-(methylamino)-5-nitrobenzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-2-(methylamino)-5-nitrobenzamide |
|---|---|
| PubChem CID | 55454611 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-2-(methylamino)-5-nitrobenzamide |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)c1cc([N+](=O)[O-])ccc1NC |
| InChI | InChI=1S/C18H19N3O5/c1-3-20(10-12-4-7-16-17(8-12)26-11-25-16)18(22)14-9-13(21(23)24)5-6-15(14)19-2/h4-9,19H,3,10-11H2,1-2H3 |
| InChIKey | AJIKMZIBYZTABE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|