C18H19N3O5 — CID 86855236
1-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[(3-nitrophenyl)methyl]urea (PubChem CID 86855236) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[(3-nitrophenyl)methyl]urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[(3-nitrophenyl)methyl]urea |
|---|---|
| PubChem CID | 86855236 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-[(3-nitrophenyl)methyl]urea |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)NCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19N3O5/c1-2-20(11-14-6-7-16-17(9-14)26-12-25-16)18(22)19-10-13-4-3-5-15(8-13)21(23)24/h3-9H,2,10-12H2,1H3,(H,19,22) |
| InChIKey | AEYDDLNUGFGQBZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|