2-[1,3-benzodioxol-5-ylmethylcarbamoyl(ethyl)amino]acetic acid

C13H16N2O5 — CID 62905595

IUPAC2-[1,3-benzodioxol-5-ylmethylcarbamoyl(ethyl)amino]acetic acid
SMILESCCN(CC(=O)O)C(=O)NCc1ccc2c(c1)OCO2
InChIInChI=1S/C13H16N2O5/c1-2-15(7-12(16)17)13(18)14-6-9-3-4-10-11(5-9)20-8-19-10/h3-5H,2,6-8H2,1H3,(H,14,18)(H,16,17)
InChIKeyZRHRVOFLTUMXOF-UHFFFAOYSA-N
MW280.28 g/mol
LogP1.03
Rot. Bonds5

About 2-[1,3-benzodioxol-5-ylmethylcarbamoyl(ethyl)amino]acetic acid

2-[1,3-benzodioxol-5-ylmethylcarbamoyl(ethyl)amino]acetic acid (PubChem CID 62905595) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-[1,3-benzodioxol-5-ylmethylcarbamoyl(ethyl)amino]acetic acid.

Molecular Properties

Compound Name2-[1,3-benzodioxol-5-ylmethylcarbamoyl(ethyl)amino]acetic acid
PubChem CID62905595
Molecular FormulaC13H16N2O5
Molecular Weight280.28 g/mol
Exact Mass280.11
IUPAC Name2-[1,3-benzodioxol-5-ylmethylcarbamoyl(ethyl)amino]acetic acid
SMILESCCN(CC(=O)O)C(=O)NCc1ccc2c(c1)OCO2
InChIInChI=1S/C13H16N2O5/c1-2-15(7-12(16)17)13(18)14-6-9-3-4-10-11(5-9)20-8-19-10/h3-5H,2,6-8H2,1H3,(H,14,18)(H,16,17)
InChIKeyZRHRVOFLTUMXOF-UHFFFAOYSA-N
XLogP1.03
TPSA88.10 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.28
LogP ≤ 51.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-[1,3-benzodioxol-5-ylmethylcarbamoyl(ethyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1,3-benzodioxol-5-ylmethylcarbamoyl(ethyl)amino]acetic acid?
The IUPAC name of 2-[1,3-benzodioxol-5-ylmethylcarbamoyl(ethyl)amino]acetic acid (CID 62905595) is 2-[1,3-benzodioxol-5-ylmethylcarbamoyl(ethyl)amino]acetic acid.
What is the SMILES notation for 2-[1,3-benzodioxol-5-ylmethylcarbamoyl(ethyl)amino]acetic acid?
The canonical SMILES for 2-[1,3-benzodioxol-5-ylmethylcarbamoyl(ethyl)amino]acetic acid is CCN(CC(=O)O)C(=O)NCc1ccc2c(c1)OCO2.
What is the InChIKey of 2-[1,3-benzodioxol-5-ylmethylcarbamoyl(ethyl)amino]acetic acid?
The InChIKey is ZRHRVOFLTUMXOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O5/c1-2-15(7-12(16)17)13(18)14-6-9-3-4-10-11(5-9)20-8-19-10/h3-5H,2,6-8H2,1H3,(H,14,18)(H,16,17).
What are the key properties of 2-[1,3-benzodioxol-5-ylmethylcarbamoyl(ethyl)amino]acetic acid?
2-[1,3-benzodioxol-5-ylmethylcarbamoyl(ethyl)amino]acetic acid has a molecular weight of 280.28 g/mol, XLogP of 1.03, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,3-benzodioxol-5-ylmethylcarbamoyl(ethyl)amino]acetic acid is sourced from PubChem (CID 62905595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).