C17H17N3O5S — CID 8008670
1-(1,3-benzodioxol-5-ylmethyl)-3-[(2S)-2-hydroxy-2-(4-nitrophenyl)ethyl]thiourea (PubChem CID 8008670) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[(2S)-2-hydroxy-2-(4-nitrophenyl)ethyl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(2S)-2-hydroxy-2-(4-nitrophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 8008670 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(2S)-2-hydroxy-2-(4-nitrophenyl)ethyl]thiourea |
| SMILES | O=[N+]([O-])c1ccc([C@H](O)CNC(=S)NCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H17N3O5S/c21-14(12-2-4-13(5-3-12)20(22)23)9-19-17(26)18-8-11-1-6-15-16(7-11)25-10-24-15/h1-7,14,21H,8-10H2,(H2,18,19,26)/t14-/m1/s1 |
| InChIKey | RHPPOQWODLOVPC-CQSZACIVSA-N |
| XLogP | 2.02 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|