C17H12N4O6 — CID 41179036
N-[5-(1,3-benzodioxol-5-ylmethyl)-1,3,4-oxadiazol-2-yl]-4-nitrobenzamide (PubChem CID 41179036) has the molecular formula C17H12N4O6 and a molecular weight of 368.31 g/mol. Its IUPAC name is N-[5-(1,3-benzodioxol-5-ylmethyl)-1,3,4-oxadiazol-2-yl]-4-nitrobenzamide.
| Compound Name | N-[5-(1,3-benzodioxol-5-ylmethyl)-1,3,4-oxadiazol-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 41179036 |
| Molecular Formula | C17H12N4O6 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | N-[5-(1,3-benzodioxol-5-ylmethyl)-1,3,4-oxadiazol-2-yl]-4-nitrobenzamide |
| SMILES | O=C(Nc1nnc(Cc2ccc3c(c2)OCO3)o1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H12N4O6/c22-16(11-2-4-12(5-3-11)21(23)24)18-17-20-19-15(27-17)8-10-1-6-13-14(7-10)26-9-25-13/h1-7H,8-9H2,(H,18,20,22) |
| InChIKey | KTVMBRATNFZAKA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|