C24H17N3O5 — CID 41179053
N-[5-(1,3-benzodioxol-5-ylmethyl)-1,3,4-oxadiazol-2-yl]-4-benzoylbenzamide (PubChem CID 41179053) has the molecular formula C24H17N3O5 and a molecular weight of 427.42 g/mol. Its IUPAC name is N-[5-(1,3-benzodioxol-5-ylmethyl)-1,3,4-oxadiazol-2-yl]-4-benzoylbenzamide.
| Compound Name | N-[5-(1,3-benzodioxol-5-ylmethyl)-1,3,4-oxadiazol-2-yl]-4-benzoylbenzamide |
|---|---|
| PubChem CID | 41179053 |
| Molecular Formula | C24H17N3O5 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | N-[5-(1,3-benzodioxol-5-ylmethyl)-1,3,4-oxadiazol-2-yl]-4-benzoylbenzamide |
| SMILES | O=C(Nc1nnc(Cc2ccc3c(c2)OCO3)o1)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H17N3O5/c28-22(16-4-2-1-3-5-16)17-7-9-18(10-8-17)23(29)25-24-27-26-21(32-24)13-15-6-11-19-20(12-15)31-14-30-19/h1-12H,13-14H2,(H,25,27,29) |
| InChIKey | OGZHNSNKMNBHOL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |