C14H18Cl2N2S — CID 50988268
4-phenyl-2-piperidin-4-yl-1,3-thiazole;dihydrochloride (PubChem CID 50988268) has the molecular formula C14H18Cl2N2S and a molecular weight of 317.28 g/mol. Its IUPAC name is 4-phenyl-2-piperidin-4-yl-1,3-thiazole;dihydrochloride.
| Compound Name | 4-phenyl-2-piperidin-4-yl-1,3-thiazole;dihydrochloride |
|---|---|
| PubChem CID | 50988268 |
| Molecular Formula | C14H18Cl2N2S |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 4-phenyl-2-piperidin-4-yl-1,3-thiazole;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(-c2csc(C3CCNCC3)n2)cc1 |
| InChI | InChI=1S/C14H16N2S.2ClH/c1-2-4-11(5-3-1)13-10-17-14(16-13)12-6-8-15-9-7-12;;/h1-5,10,12,15H,6-9H2;2*1H |
| InChIKey | ASBVVECHUDKEPQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |