C14H16Cl2N2S — CID 71677757
4-(4-chlorophenyl)-2-piperidin-4-yl-1,3-thiazole;hydron;chloride (PubChem CID 71677757) has the molecular formula C14H16Cl2N2S and a molecular weight of 315.27 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-piperidin-4-yl-1,3-thiazole;hydron;chloride.
| Compound Name | 4-(4-chlorophenyl)-2-piperidin-4-yl-1,3-thiazole;hydron;chloride |
|---|---|
| PubChem CID | 71677757 |
| Molecular Formula | C14H16Cl2N2S |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 4-(4-chlorophenyl)-2-piperidin-4-yl-1,3-thiazole;hydron;chloride |
| SMILES | Clc1ccc(-c2csc(C3CCNCC3)n2)cc1.[Cl-].[H+] |
| InChI | InChI=1S/C14H15ClN2S.ClH/c15-12-3-1-10(2-4-12)13-9-18-14(17-13)11-5-7-16-8-6-11;/h1-4,9,11,16H,5-8H2;1H |
| InChIKey | ARYDLAHZMYCTEI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |