About 4-(4-chlorophenyl)-2-piperidin-4-yl-1,3-thiazole;hydron;chloride
4-(4-chlorophenyl)-2-piperidin-4-yl-1,3-thiazole;hydron;chloride (PubChem CID 71677757) has the molecular formula C14H16Cl2N2S
and a molecular weight of 315.27 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-piperidin-4-yl-1,3-thiazole;hydron;chloride.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-2-piperidin-4-yl-1,3-thiazole;hydron;chloride |
| PubChem CID | 71677757 |
| Molecular Formula | C14H16Cl2N2S |
| Molecular Weight | 315.27 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 4-(4-chlorophenyl)-2-piperidin-4-yl-1,3-thiazole;hydron;chloride |
| SMILES | Clc1ccc(-c2csc(C3CCNCC3)n2)cc1.[Cl-].[H+] |
| InChI | InChI=1S/C14H15ClN2S.ClH/c15-12-3-1-10(2-4-12)13-9-18-14(17-13)11-5-7-16-8-6-11;/h1-4,9,11,16H,5-8H2;1H |
| InChIKey | ARYDLAHZMYCTEI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-chlorophenyl)-2-piperidin-4-yl-1,3-thiazole;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-2-piperidin-4-yl-1,3-thiazole;hydron;chloride?
The IUPAC name of 4-(4-chlorophenyl)-2-piperidin-4-yl-1,3-thiazole;hydron;chloride (CID 71677757) is 4-(4-chlorophenyl)-2-piperidin-4-yl-1,3-thiazole;hydron;chloride.
What is the SMILES notation for 4-(4-chlorophenyl)-2-piperidin-4-yl-1,3-thiazole;hydron;chloride?
The canonical SMILES for 4-(4-chlorophenyl)-2-piperidin-4-yl-1,3-thiazole;hydron;chloride is Clc1ccc(-c2csc(C3CCNCC3)n2)cc1.[Cl-].[H+].
What is the InChIKey of 4-(4-chlorophenyl)-2-piperidin-4-yl-1,3-thiazole;hydron;chloride?
The InChIKey is ARYDLAHZMYCTEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN2S.ClH/c15-12-3-1-10(2-4-12)13-9-18-14(17-13)11-5-7-16-8-6-11;/h1-4,9,11,16H,5-8H2;1H.
What are the key properties of 4-(4-chlorophenyl)-2-piperidin-4-yl-1,3-thiazole;hydron;chloride?
4-(4-chlorophenyl)-2-piperidin-4-yl-1,3-thiazole;hydron;chloride has a molecular weight of 315.27 g/mol, XLogP of 1.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-2-piperidin-4-yl-1,3-thiazole;hydron;chloride is sourced from PubChem (CID 71677757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).