C16H13ClN2S — CID 742475
2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-cyclopentylideneacetonitrile (PubChem CID 742475) has the molecular formula C16H13ClN2S and a molecular weight of 300.81 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-cyclopentylideneacetonitrile.
| Compound Name | 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-cyclopentylideneacetonitrile |
|---|---|
| PubChem CID | 742475 |
| Molecular Formula | C16H13ClN2S |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-cyclopentylideneacetonitrile |
| SMILES | N#CC(=C1CCCC1)c1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C16H13ClN2S/c17-13-7-5-12(6-8-13)15-10-20-16(19-15)14(9-18)11-3-1-2-4-11/h5-8,10H,1-4H2 |
| InChIKey | FZSMTMWLJIFRND-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|