C10H7Cl2NS — CID 2063595
4-(chloromethyl)-2-(2-chlorophenyl)-1,3-thiazole (PubChem CID 2063595) has the molecular formula C10H7Cl2NS and a molecular weight of 244.15 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(2-chlorophenyl)-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-(2-chlorophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 2063595 |
| Molecular Formula | C10H7Cl2NS |
| Molecular Weight | 244.15 g/mol |
| Exact Mass | 242.97 |
| IUPAC Name | 4-(chloromethyl)-2-(2-chlorophenyl)-1,3-thiazole |
| SMILES | ClCc1csc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C10H7Cl2NS/c11-5-7-6-14-10(13-7)8-3-1-2-4-9(8)12/h1-4,6H,5H2 |
| InChIKey | SORQUIQQZNHWIP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.15 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|