C16H20N4S2 — CID 1447486
N-methyl-4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]piperazine-1-carbothioamide (PubChem CID 1447486) has the molecular formula C16H20N4S2 and a molecular weight of 332.50 g/mol. Its IUPAC name is N-methyl-4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]piperazine-1-carbothioamide.
| Compound Name | N-methyl-4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 1447486 |
| Molecular Formula | C16H20N4S2 |
| Molecular Weight | 332.50 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | N-methyl-4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]piperazine-1-carbothioamide |
| SMILES | CNC(=S)N1CCN(c2nc(-c3ccc(C)cc3)cs2)CC1 |
| InChI | InChI=1S/C16H20N4S2/c1-12-3-5-13(6-4-12)14-11-22-16(18-14)20-9-7-19(8-10-20)15(21)17-2/h3-6,11H,7-10H2,1-2H3,(H,17,21) |
| InChIKey | UUFBBTJIAKVBAO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|