C22H23FN4OS2 — CID 1447258
N-(2-ethoxyphenyl)-4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazine-1-carbothioamide (PubChem CID 1447258) has the molecular formula C22H23FN4OS2 and a molecular weight of 442.59 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazine-1-carbothioamide.
| Compound Name | N-(2-ethoxyphenyl)-4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 1447258 |
| Molecular Formula | C22H23FN4OS2 |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N-(2-ethoxyphenyl)-4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazine-1-carbothioamide |
| SMILES | CCOc1ccccc1NC(=S)N1CCN(c2nc(-c3ccc(F)cc3)cs2)CC1 |
| InChI | InChI=1S/C22H23FN4OS2/c1-2-28-20-6-4-3-5-18(20)24-21(29)26-11-13-27(14-12-26)22-25-19(15-30-22)16-7-9-17(23)10-8-16/h3-10,15H,2,11-14H2,1H3,(H,24,29) |
| InChIKey | SUHLUAXTVRBQLB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|