C12H16N2OS2 — CID 23907854
N-(2-ethoxyphenyl)-1,3-thiazolidine-3-carbothioamide (PubChem CID 23907854) has the molecular formula C12H16N2OS2 and a molecular weight of 268.41 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-1,3-thiazolidine-3-carbothioamide.
| Compound Name | N-(2-ethoxyphenyl)-1,3-thiazolidine-3-carbothioamide |
|---|---|
| PubChem CID | 23907854 |
| Molecular Formula | C12H16N2OS2 |
| Molecular Weight | 268.41 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | N-(2-ethoxyphenyl)-1,3-thiazolidine-3-carbothioamide |
| SMILES | CCOc1ccccc1NC(=S)N1CCSC1 |
| InChI | InChI=1S/C12H16N2OS2/c1-2-15-11-6-4-3-5-10(11)13-12(16)14-7-8-17-9-14/h3-6H,2,7-9H2,1H3,(H,13,16) |
| InChIKey | PCXITKAKKWODNK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|