C22H28N4O2S — CID 3738607
2-[4-[(2-ethoxyphenyl)carbamothioyl]piperazin-1-yl]-N-methyl-N-phenylacetamide (PubChem CID 3738607) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is 2-[4-[(2-ethoxyphenyl)carbamothioyl]piperazin-1-yl]-N-methyl-N-phenylacetamide.
| Compound Name | 2-[4-[(2-ethoxyphenyl)carbamothioyl]piperazin-1-yl]-N-methyl-N-phenylacetamide |
|---|---|
| PubChem CID | 3738607 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 2-[4-[(2-ethoxyphenyl)carbamothioyl]piperazin-1-yl]-N-methyl-N-phenylacetamide |
| SMILES | CCOc1ccccc1NC(=S)N1CCN(CC(=O)N(C)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H28N4O2S/c1-3-28-20-12-8-7-11-19(20)23-22(29)26-15-13-25(14-16-26)17-21(27)24(2)18-9-5-4-6-10-18/h4-12H,3,13-17H2,1-2H3,(H,23,29) |
| InChIKey | KIRIGAXXAPJEFQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|