C22H26N4O3S — CID 74227686
2-[4-(1,3-benzodioxol-5-ylmethylcarbamothioyl)piperazin-1-yl]-N-methyl-N-phenylacetamide (PubChem CID 74227686) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-ylmethylcarbamothioyl)piperazin-1-yl]-N-methyl-N-phenylacetamide.
| Compound Name | 2-[4-(1,3-benzodioxol-5-ylmethylcarbamothioyl)piperazin-1-yl]-N-methyl-N-phenylacetamide |
|---|---|
| PubChem CID | 74227686 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-ylmethylcarbamothioyl)piperazin-1-yl]-N-methyl-N-phenylacetamide |
| SMILES | CN(C(=O)CN1CCN(C(=S)NCc2ccc3c(c2)OCO3)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H26N4O3S/c1-24(18-5-3-2-4-6-18)21(27)15-25-9-11-26(12-10-25)22(30)23-14-17-7-8-19-20(13-17)29-16-28-19/h2-8,13H,9-12,14-16H2,1H3,(H,23,30) |
| InChIKey | JQLAVCHRYLBCGM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|