C16H19FN2OS — CID 133371636
2-(4-ethoxypiperidin-1-yl)-4-(4-fluorophenyl)-1,3-thiazole (PubChem CID 133371636) has the molecular formula C16H19FN2OS and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-(4-ethoxypiperidin-1-yl)-4-(4-fluorophenyl)-1,3-thiazole.
| Compound Name | 2-(4-ethoxypiperidin-1-yl)-4-(4-fluorophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 133371636 |
| Molecular Formula | C16H19FN2OS |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-(4-ethoxypiperidin-1-yl)-4-(4-fluorophenyl)-1,3-thiazole |
| SMILES | CCOC1CCN(c2nc(-c3ccc(F)cc3)cs2)CC1 |
| InChI | InChI=1S/C16H19FN2OS/c1-2-20-14-7-9-19(10-8-14)16-18-15(11-21-16)12-3-5-13(17)6-4-12/h3-6,11,14H,2,7-10H2,1H3 |
| InChIKey | DSCURJYCGMZBNE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |