C16H20FN3S — CID 166238024
3-ethyl-1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidin-4-amine (PubChem CID 166238024) has the molecular formula C16H20FN3S and a molecular weight of 305.42 g/mol. Its IUPAC name is 3-ethyl-1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidin-4-amine.
| Compound Name | 3-ethyl-1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 166238024 |
| Molecular Formula | C16H20FN3S |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 3-ethyl-1-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperidin-4-amine |
| SMILES | CCC1CN(c2nc(-c3ccc(F)cc3)cs2)CCC1N |
| InChI | InChI=1S/C16H20FN3S/c1-2-11-9-20(8-7-14(11)18)16-19-15(10-21-16)12-3-5-13(17)6-4-12/h3-6,10-11,14H,2,7-9,18H2,1H3 |
| InChIKey | DDROCVDXOSUNAF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |