C21H21ClN4OS2 — CID 3223742
4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-(4-methoxyphenyl)piperazine-1-carbothioamide (PubChem CID 3223742) has the molecular formula C21H21ClN4OS2 and a molecular weight of 445.01 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-(4-methoxyphenyl)piperazine-1-carbothioamide.
| Compound Name | 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-(4-methoxyphenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3223742 |
| Molecular Formula | C21H21ClN4OS2 |
| Molecular Weight | 445.01 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-(4-methoxyphenyl)piperazine-1-carbothioamide |
| SMILES | COc1ccc(NC(=S)N2CCN(c3nc(-c4ccc(Cl)cc4)cs3)CC2)cc1 |
| InChI | InChI=1S/C21H21ClN4OS2/c1-27-18-8-6-17(7-9-18)23-20(28)25-10-12-26(13-11-25)21-24-19(14-29-21)15-2-4-16(22)5-3-15/h2-9,14H,10-13H2,1H3,(H,23,28) |
| InChIKey | QIKMSIOYXCDUGO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.01 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|