C18H23ClN4S2 — CID 3223722
4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-(2-methylpropyl)piperazine-1-carbothioamide (PubChem CID 3223722) has the molecular formula C18H23ClN4S2 and a molecular weight of 395.00 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-(2-methylpropyl)piperazine-1-carbothioamide.
| Compound Name | 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-(2-methylpropyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3223722 |
| Molecular Formula | C18H23ClN4S2 |
| Molecular Weight | 395.00 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 4-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N-(2-methylpropyl)piperazine-1-carbothioamide |
| SMILES | CC(C)CNC(=S)N1CCN(c2nc(-c3ccc(Cl)cc3)cs2)CC1 |
| InChI | InChI=1S/C18H23ClN4S2/c1-13(2)11-20-17(24)22-7-9-23(10-8-22)18-21-16(12-25-18)14-3-5-15(19)6-4-14/h3-6,12-13H,7-11H2,1-2H3,(H,20,24) |
| InChIKey | RQJOQECENSPTND-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.00 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|