C21H30FN5S2 — CID 3223620
N-[3-(diethylamino)propyl]-4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazine-1-carbothioamide (PubChem CID 3223620) has the molecular formula C21H30FN5S2 and a molecular weight of 435.64 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazine-1-carbothioamide.
| Compound Name | N-[3-(diethylamino)propyl]-4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3223620 |
| Molecular Formula | C21H30FN5S2 |
| Molecular Weight | 435.64 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | N-[3-(diethylamino)propyl]-4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazine-1-carbothioamide |
| SMILES | CCN(CC)CCCNC(=S)N1CCN(c2nc(-c3ccc(F)cc3)cs2)CC1 |
| InChI | InChI=1S/C21H30FN5S2/c1-3-25(4-2)11-5-10-23-20(28)26-12-14-27(15-13-26)21-24-19(16-29-21)17-6-8-18(22)9-7-17/h6-9,16H,3-5,10-15H2,1-2H3,(H,23,28) |
| InChIKey | FSKSDDYTVAGMMN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 34.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.64 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|