C23H26N4S2 — CID 1447493
N-(2-ethylphenyl)-4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]piperazine-1-carbothioamide (PubChem CID 1447493) has the molecular formula C23H26N4S2 and a molecular weight of 422.62 g/mol. Its IUPAC name is N-(2-ethylphenyl)-4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]piperazine-1-carbothioamide.
| Compound Name | N-(2-ethylphenyl)-4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 1447493 |
| Molecular Formula | C23H26N4S2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-(2-ethylphenyl)-4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]piperazine-1-carbothioamide |
| SMILES | CCc1ccccc1NC(=S)N1CCN(c2nc(-c3ccc(C)cc3)cs2)CC1 |
| InChI | InChI=1S/C23H26N4S2/c1-3-18-6-4-5-7-20(18)24-22(28)26-12-14-27(15-13-26)23-25-21(16-29-23)19-10-8-17(2)9-11-19/h4-11,16H,3,12-15H2,1-2H3,(H,24,28) |
| InChIKey | BUBIBTGDIRMJCY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|