C22H24N4OS2 — CID 1447422
N-(4-ethoxyphenyl)-4-(4-phenyl-1,3-thiazol-2-yl)piperazine-1-carbothioamide (PubChem CID 1447422) has the molecular formula C22H24N4OS2 and a molecular weight of 424.60 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-(4-phenyl-1,3-thiazol-2-yl)piperazine-1-carbothioamide.
| Compound Name | N-(4-ethoxyphenyl)-4-(4-phenyl-1,3-thiazol-2-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 1447422 |
| Molecular Formula | C22H24N4OS2 |
| Molecular Weight | 424.60 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-(4-phenyl-1,3-thiazol-2-yl)piperazine-1-carbothioamide |
| SMILES | CCOc1ccc(NC(=S)N2CCN(c3nc(-c4ccccc4)cs3)CC2)cc1 |
| InChI | InChI=1S/C22H24N4OS2/c1-2-27-19-10-8-18(9-11-19)23-21(28)25-12-14-26(15-13-25)22-24-20(16-29-22)17-6-4-3-5-7-17/h3-11,16H,2,12-15H2,1H3,(H,23,28) |
| InChIKey | LOVXYQAKVMBHNI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|