C29H30N2O2S — CID 90316479
[1-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-diphenylmethanol (PubChem CID 90316479) has the molecular formula C29H30N2O2S and a molecular weight of 470.64 g/mol. Its IUPAC name is [1-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-diphenylmethanol.
| Compound Name | [1-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 90316479 |
| Molecular Formula | C29H30N2O2S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | [1-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]piperidin-4-yl]-diphenylmethanol |
| SMILES | CCOc1ccc(-c2csc(N3CCC(C(O)(c4ccccc4)c4ccccc4)CC3)n2)cc1 |
| InChI | InChI=1S/C29H30N2O2S/c1-2-33-26-15-13-22(14-16-26)27-21-34-28(30-27)31-19-17-25(18-20-31)29(32,23-9-5-3-6-10-23)24-11-7-4-8-12-24/h3-16,21,25,32H,2,17-20H2,1H3 |
| InChIKey | GJCCZPUDEVAEPH-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |