C20H27N5O2S — CID 1447479
2-methyl-N'-[2-[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]piperazin-1-yl]acetyl]propanehydrazide (PubChem CID 1447479) has the molecular formula C20H27N5O2S and a molecular weight of 401.54 g/mol. Its IUPAC name is 2-methyl-N'-[2-[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]piperazin-1-yl]acetyl]propanehydrazide.
| Compound Name | 2-methyl-N'-[2-[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]piperazin-1-yl]acetyl]propanehydrazide |
|---|---|
| PubChem CID | 1447479 |
| Molecular Formula | C20H27N5O2S |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 2-methyl-N'-[2-[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]piperazin-1-yl]acetyl]propanehydrazide |
| SMILES | Cc1ccc(-c2csc(N3CCN(CC(=O)NNC(=O)C(C)C)CC3)n2)cc1 |
| InChI | InChI=1S/C20H27N5O2S/c1-14(2)19(27)23-22-18(26)12-24-8-10-25(11-9-24)20-21-17(13-28-20)16-6-4-15(3)5-7-16/h4-7,13-14H,8-12H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | LXZRPBLDSXNNNO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|