C19H26N5O2S+ — CID 7435853
2-methyl-N'-[2-[4-(4-phenyl-1,3-thiazol-2-yl)piperazin-1-ium-1-yl]acetyl]propanehydrazide (PubChem CID 7435853) has the molecular formula C19H26N5O2S+ and a molecular weight of 388.52 g/mol. Its IUPAC name is 2-methyl-N'-[2-[4-(4-phenyl-1,3-thiazol-2-yl)piperazin-1-ium-1-yl]acetyl]propanehydrazide.
| Compound Name | 2-methyl-N'-[2-[4-(4-phenyl-1,3-thiazol-2-yl)piperazin-1-ium-1-yl]acetyl]propanehydrazide |
|---|---|
| PubChem CID | 7435853 |
| Molecular Formula | C19H26N5O2S+ |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 2-methyl-N'-[2-[4-(4-phenyl-1,3-thiazol-2-yl)piperazin-1-ium-1-yl]acetyl]propanehydrazide |
| SMILES | CC(C)C(=O)NNC(=O)C[NH+]1CCN(c2nc(-c3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C19H25N5O2S/c1-14(2)18(26)22-21-17(25)12-23-8-10-24(11-9-23)19-20-16(13-27-19)15-6-4-3-5-7-15/h3-7,13-14H,8-12H2,1-2H3,(H,21,25)(H,22,26)/p+1 |
| InChIKey | MTWSNAUNYRGYIB-UHFFFAOYSA-O |
| XLogP | 0.32 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|