C20H28N4OS — CID 57199831
4-(4-phenyl-1,3-thiazol-2-yl)-N,N-dipropylpiperazine-1-carboxamide (PubChem CID 57199831) has the molecular formula C20H28N4OS and a molecular weight of 372.54 g/mol. Its IUPAC name is 4-(4-phenyl-1,3-thiazol-2-yl)-N,N-dipropylpiperazine-1-carboxamide.
| Compound Name | 4-(4-phenyl-1,3-thiazol-2-yl)-N,N-dipropylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 57199831 |
| Molecular Formula | C20H28N4OS |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 4-(4-phenyl-1,3-thiazol-2-yl)-N,N-dipropylpiperazine-1-carboxamide |
| SMILES | CCCN(CCC)C(=O)N1CCN(c2nc(-c3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C20H28N4OS/c1-3-10-23(11-4-2)20(25)24-14-12-22(13-15-24)19-21-18(16-26-19)17-8-6-5-7-9-17/h5-9,16H,3-4,10-15H2,1-2H3 |
| InChIKey | OEVVVNDIFHWTBC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |