C15H20N4S — CID 82167588
2-[4-(4-phenyl-1,3-thiazol-2-yl)piperazin-1-yl]ethanamine (PubChem CID 82167588) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is 2-[4-(4-phenyl-1,3-thiazol-2-yl)piperazin-1-yl]ethanamine.
| Compound Name | 2-[4-(4-phenyl-1,3-thiazol-2-yl)piperazin-1-yl]ethanamine |
|---|---|
| PubChem CID | 82167588 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2-[4-(4-phenyl-1,3-thiazol-2-yl)piperazin-1-yl]ethanamine |
| SMILES | NCCN1CCN(c2nc(-c3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C15H20N4S/c16-6-7-18-8-10-19(11-9-18)15-17-14(12-20-15)13-4-2-1-3-5-13/h1-5,12H,6-11,16H2 |
| InChIKey | MVQPGEHBVDJNLE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |