C19H19N5OS — CID 133371880
2-[4-(4-phenyl-1,3-thiazol-2-yl)piperazin-1-yl]pyridine-3-carboxamide (PubChem CID 133371880) has the molecular formula C19H19N5OS and a molecular weight of 365.46 g/mol. Its IUPAC name is 2-[4-(4-phenyl-1,3-thiazol-2-yl)piperazin-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-[4-(4-phenyl-1,3-thiazol-2-yl)piperazin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 133371880 |
| Molecular Formula | C19H19N5OS |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 2-[4-(4-phenyl-1,3-thiazol-2-yl)piperazin-1-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1N1CCN(c2nc(-c3ccccc3)cs2)CC1 |
| InChI | InChI=1S/C19H19N5OS/c20-17(25)15-7-4-8-21-18(15)23-9-11-24(12-10-23)19-22-16(13-26-19)14-5-2-1-3-6-14/h1-8,13H,9-12H2,(H2,20,25) |
| InChIKey | PJRFODPQUDOGIE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |