C14H14ClN3O2S — CID 68778558
4-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylic acid (PubChem CID 68778558) has the molecular formula C14H14ClN3O2S and a molecular weight of 323.81 g/mol. Its IUPAC name is 4-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylic acid.
| Compound Name | 4-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 68778558 |
| Molecular Formula | C14H14ClN3O2S |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 4-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(c2nc(-c3ccccc3Cl)cs2)CC1 |
| InChI | InChI=1S/C14H14ClN3O2S/c15-11-4-2-1-3-10(11)12-9-21-13(16-12)17-5-7-18(8-6-17)14(19)20/h1-4,9H,5-8H2,(H,19,20) |
| InChIKey | IVAMGBBLKITTAZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |